C20H24N2O3 — CID 51969580
(2S)-2-(1,3-benzodioxol-5-ylamino)-N-[(2R)-4-phenylbutan-2-yl]propanamide (PubChem CID 51969580) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is (2S)-2-(1,3-benzodioxol-5-ylamino)-N-[(2R)-4-phenylbutan-2-yl]propanamide.
| Compound Name | (2S)-2-(1,3-benzodioxol-5-ylamino)-N-[(2R)-4-phenylbutan-2-yl]propanamide |
|---|---|
| PubChem CID | 51969580 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | (2S)-2-(1,3-benzodioxol-5-ylamino)-N-[(2R)-4-phenylbutan-2-yl]propanamide |
| SMILES | C[C@H](CCc1ccccc1)NC(=O)[C@H](C)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H24N2O3/c1-14(8-9-16-6-4-3-5-7-16)21-20(23)15(2)22-17-10-11-18-19(12-17)25-13-24-18/h3-7,10-12,14-15,22H,8-9,13H2,1-2H3,(H,21,23)/t14-,15+/m1/s1 |
| InChIKey | NCBKZHKSDSLAMA-CABCVRRESA-N |
| XLogP | 3.35 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|