C23H22N2O4 — CID 71903508
2-(1,3-benzodioxol-5-ylamino)-N-(4-phenylmethoxyphenyl)propanamide (PubChem CID 71903508) has the molecular formula C23H22N2O4 and a molecular weight of 390.44 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylamino)-N-(4-phenylmethoxyphenyl)propanamide.
| Compound Name | 2-(1,3-benzodioxol-5-ylamino)-N-(4-phenylmethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 71903508 |
| Molecular Formula | C23H22N2O4 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylamino)-N-(4-phenylmethoxyphenyl)propanamide |
| SMILES | CC(Nc1ccc2c(c1)OCO2)C(=O)Nc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C23H22N2O4/c1-16(24-19-9-12-21-22(13-19)29-15-28-21)23(26)25-18-7-10-20(11-8-18)27-14-17-5-3-2-4-6-17/h2-13,16,24H,14-15H2,1H3,(H,25,26) |
| InChIKey | NJNFIBZFNDCLOE-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|