C20H23N3O5 — CID 55598497
N-(1,3-benzodioxol-5-yl)-2-[4-[2-(ethylamino)-2-oxoethoxy]anilino]propanamide (PubChem CID 55598497) has the molecular formula C20H23N3O5 and a molecular weight of 385.42 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-[4-[2-(ethylamino)-2-oxoethoxy]anilino]propanamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-[4-[2-(ethylamino)-2-oxoethoxy]anilino]propanamide |
|---|---|
| PubChem CID | 55598497 |
| Molecular Formula | C20H23N3O5 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-[4-[2-(ethylamino)-2-oxoethoxy]anilino]propanamide |
| SMILES | CCNC(=O)COc1ccc(NC(C)C(=O)Nc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C20H23N3O5/c1-3-21-19(24)11-26-16-7-4-14(5-8-16)22-13(2)20(25)23-15-6-9-17-18(10-15)28-12-27-17/h4-10,13,22H,3,11-12H2,1-2H3,(H,21,24)(H,23,25) |
| InChIKey | MCBDWTAMJJTYQA-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|