C19H22N2O6 — CID 51167835
N-(1,3-benzodioxol-5-yl)-2-(3,4,5-trimethoxyanilino)propanamide (PubChem CID 51167835) has the molecular formula C19H22N2O6 and a molecular weight of 374.39 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-(3,4,5-trimethoxyanilino)propanamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-(3,4,5-trimethoxyanilino)propanamide |
|---|---|
| PubChem CID | 51167835 |
| Molecular Formula | C19H22N2O6 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-(3,4,5-trimethoxyanilino)propanamide |
| SMILES | COc1cc(NC(C)C(=O)Nc2ccc3c(c2)OCO3)cc(OC)c1OC |
| InChI | InChI=1S/C19H22N2O6/c1-11(19(22)21-12-5-6-14-15(7-12)27-10-26-14)20-13-8-16(23-2)18(25-4)17(9-13)24-3/h5-9,11,20H,10H2,1-4H3,(H,21,22) |
| InChIKey | PVJBMMDGPWMEKS-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 87.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|