C10H11NO4 — CID 94681442
(2R)-N-(1,3-benzodioxol-5-yl)-2-hydroxypropanamide (PubChem CID 94681442) has the molecular formula C10H11NO4 and a molecular weight of 209.20 g/mol. Its IUPAC name is (2R)-N-(1,3-benzodioxol-5-yl)-2-hydroxypropanamide.
| Compound Name | (2R)-N-(1,3-benzodioxol-5-yl)-2-hydroxypropanamide |
|---|---|
| PubChem CID | 94681442 |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 209.20 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | (2R)-N-(1,3-benzodioxol-5-yl)-2-hydroxypropanamide |
| SMILES | C[C@@H](O)C(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C10H11NO4/c1-6(12)10(13)11-7-2-3-8-9(4-7)15-5-14-8/h2-4,6,12H,5H2,1H3,(H,11,13)/t6-/m1/s1 |
| InChIKey | DEDYDJBOLQRCQS-ZCFIWIBFSA-N |
| XLogP | 0.73 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.20 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |