C11H14N2O3 — CID 79025249
(2S)-2-amino-N-(1,3-benzodioxol-5-yl)butanamide (PubChem CID 79025249) has the molecular formula C11H14N2O3 and a molecular weight of 222.24 g/mol. Its IUPAC name is (2S)-2-amino-N-(1,3-benzodioxol-5-yl)butanamide.
| Compound Name | (2S)-2-amino-N-(1,3-benzodioxol-5-yl)butanamide |
|---|---|
| PubChem CID | 79025249 |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | (2S)-2-amino-N-(1,3-benzodioxol-5-yl)butanamide |
| SMILES | CC[C@H](N)C(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C11H14N2O3/c1-2-8(12)11(14)13-7-3-4-9-10(5-7)16-6-15-9/h3-5,8H,2,6,12H2,1H3,(H,13,14)/t8-/m0/s1 |
| InChIKey | AEBDKHSOZQSACB-QMMMGPOBSA-N |
| XLogP | 1.09 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |