C14H19N3O4 — CID 2373139
(2S,3S)-N-(1,3-benzodioxol-5-yl)-2-(carbamoylamino)-3-methylpentanamide (PubChem CID 2373139) has the molecular formula C14H19N3O4 and a molecular weight of 293.32 g/mol. Its IUPAC name is (2S,3S)-N-(1,3-benzodioxol-5-yl)-2-(carbamoylamino)-3-methylpentanamide.
| Compound Name | (2S,3S)-N-(1,3-benzodioxol-5-yl)-2-(carbamoylamino)-3-methylpentanamide |
|---|---|
| PubChem CID | 2373139 |
| Molecular Formula | C14H19N3O4 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | (2S,3S)-N-(1,3-benzodioxol-5-yl)-2-(carbamoylamino)-3-methylpentanamide |
| SMILES | CC[C@H](C)[C@H](NC(N)=O)C(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H19N3O4/c1-3-8(2)12(17-14(15)19)13(18)16-9-4-5-10-11(6-9)21-7-20-10/h4-6,8,12H,3,7H2,1-2H3,(H,16,18)(H3,15,17,19)/t8-,12-/m0/s1 |
| InChIKey | YDBSVCSUHVCOFG-UFBFGSQYSA-N |
| XLogP | 1.44 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |