C14H20N4O3 — CID 24640883
4-[[2-(carbamoylamino)-3-methylpentanoyl]amino]benzamide (PubChem CID 24640883) has the molecular formula C14H20N4O3 and a molecular weight of 292.34 g/mol. Its IUPAC name is 4-[[2-(carbamoylamino)-3-methylpentanoyl]amino]benzamide.
| Compound Name | 4-[[2-(carbamoylamino)-3-methylpentanoyl]amino]benzamide |
|---|---|
| PubChem CID | 24640883 |
| Molecular Formula | C14H20N4O3 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 4-[[2-(carbamoylamino)-3-methylpentanoyl]amino]benzamide |
| SMILES | CCC(C)C(NC(N)=O)C(=O)Nc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C14H20N4O3/c1-3-8(2)11(18-14(16)21)13(20)17-10-6-4-9(5-7-10)12(15)19/h4-8,11H,3H2,1-2H3,(H2,15,19)(H,17,20)(H3,16,18,21) |
| InChIKey | WUJOPSDTBSGJPN-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |