C14H18F3N3O3 — CID 3924237
2-(carbamoylamino)-3-methyl-N-[4-(trifluoromethoxy)phenyl]pentanamide (PubChem CID 3924237) has the molecular formula C14H18F3N3O3 and a molecular weight of 333.31 g/mol. Its IUPAC name is 2-(carbamoylamino)-3-methyl-N-[4-(trifluoromethoxy)phenyl]pentanamide.
| Compound Name | 2-(carbamoylamino)-3-methyl-N-[4-(trifluoromethoxy)phenyl]pentanamide |
|---|---|
| PubChem CID | 3924237 |
| Molecular Formula | C14H18F3N3O3 |
| Molecular Weight | 333.31 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 2-(carbamoylamino)-3-methyl-N-[4-(trifluoromethoxy)phenyl]pentanamide |
| SMILES | CCC(C)C(NC(N)=O)C(=O)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C14H18F3N3O3/c1-3-8(2)11(20-13(18)22)12(21)19-9-4-6-10(7-5-9)23-14(15,16)17/h4-8,11H,3H2,1-2H3,(H,19,21)(H3,18,20,22) |
| InChIKey | TUVZDGPSKZEWBT-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.31 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |