C8H7F3N2O2 — CID 2779224
[4-(trifluoromethoxy)phenyl]urea (PubChem CID 2779224) has the molecular formula C8H7F3N2O2 and a molecular weight of 220.15 g/mol. Its IUPAC name is [4-(trifluoromethoxy)phenyl]urea.
| Compound Name | [4-(trifluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 2779224 |
| Molecular Formula | C8H7F3N2O2 |
| Molecular Weight | 220.15 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | [4-(trifluoromethoxy)phenyl]urea |
| SMILES | NC(=O)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C8H7F3N2O2/c9-8(10,11)15-6-3-1-5(2-4-6)13-7(12)14/h1-4H,(H3,12,13,14) |
| InChIKey | LOSFVIMHTOMZKT-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.15 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |