C11H14ClF3N2O2 — CID 119262786
4-amino-N-[4-(trifluoromethoxy)phenyl]butanamide;hydrochloride (PubChem CID 119262786) has the molecular formula C11H14ClF3N2O2 and a molecular weight of 298.69 g/mol. Its IUPAC name is 4-amino-N-[4-(trifluoromethoxy)phenyl]butanamide;hydrochloride.
| Compound Name | 4-amino-N-[4-(trifluoromethoxy)phenyl]butanamide;hydrochloride |
|---|---|
| PubChem CID | 119262786 |
| Molecular Formula | C11H14ClF3N2O2 |
| Molecular Weight | 298.69 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 4-amino-N-[4-(trifluoromethoxy)phenyl]butanamide;hydrochloride |
| SMILES | Cl.NCCCC(=O)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C11H13F3N2O2.ClH/c12-11(13,14)18-9-5-3-8(4-6-9)16-10(17)2-1-7-15;/h3-6H,1-2,7,15H2,(H,16,17);1H |
| InChIKey | LXZRHUUMUWFBAT-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.69 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |