C15H20F3NO2S2 — CID 46871092
6,8-bis(sulfanyl)-N-[4-(trifluoromethoxy)phenyl]octanamide (PubChem CID 46871092) has the molecular formula C15H20F3NO2S2 and a molecular weight of 367.46 g/mol. Its IUPAC name is 6,8-bis(sulfanyl)-N-[4-(trifluoromethoxy)phenyl]octanamide.
| Compound Name | 6,8-bis(sulfanyl)-N-[4-(trifluoromethoxy)phenyl]octanamide |
|---|---|
| PubChem CID | 46871092 |
| Molecular Formula | C15H20F3NO2S2 |
| Molecular Weight | 367.46 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | 6,8-bis(sulfanyl)-N-[4-(trifluoromethoxy)phenyl]octanamide |
| SMILES | O=C(CCCCC(S)CCS)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C15H20F3NO2S2/c16-15(17,18)21-12-7-5-11(6-8-12)19-14(20)4-2-1-3-13(23)9-10-22/h5-8,13,22-23H,1-4,9-10H2,(H,19,20) |
| InChIKey | XTNJWOPRVFAZIF-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.46 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|