C11H13F3N2O3 — CID 71628791
2-(2-hydroxyethylamino)-N-[4-(trifluoromethoxy)phenyl]acetamide (PubChem CID 71628791) has the molecular formula C11H13F3N2O3 and a molecular weight of 278.23 g/mol. Its IUPAC name is 2-(2-hydroxyethylamino)-N-[4-(trifluoromethoxy)phenyl]acetamide.
| Compound Name | 2-(2-hydroxyethylamino)-N-[4-(trifluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 71628791 |
| Molecular Formula | C11H13F3N2O3 |
| Molecular Weight | 278.23 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 2-(2-hydroxyethylamino)-N-[4-(trifluoromethoxy)phenyl]acetamide |
| SMILES | O=C(CNCCO)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C11H13F3N2O3/c12-11(13,14)19-9-3-1-8(2-4-9)16-10(18)7-15-5-6-17/h1-4,15,17H,5-7H2,(H,16,18) |
| InChIKey | JXQYHZVJFFQVIQ-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.23 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|