C15H7F8NO2 — CID 5010640
2-(2,3,4,5,6-pentafluorophenyl)-N-[4-(trifluoromethoxy)phenyl]acetamide (PubChem CID 5010640) has the molecular formula C15H7F8NO2 and a molecular weight of 385.21 g/mol. Its IUPAC name is 2-(2,3,4,5,6-pentafluorophenyl)-N-[4-(trifluoromethoxy)phenyl]acetamide.
| Compound Name | 2-(2,3,4,5,6-pentafluorophenyl)-N-[4-(trifluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 5010640 |
| Molecular Formula | C15H7F8NO2 |
| Molecular Weight | 385.21 g/mol |
| Exact Mass | 385.03 |
| IUPAC Name | 2-(2,3,4,5,6-pentafluorophenyl)-N-[4-(trifluoromethoxy)phenyl]acetamide |
| SMILES | O=C(Cc1c(F)c(F)c(F)c(F)c1F)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C15H7F8NO2/c16-10-8(11(17)13(19)14(20)12(10)18)5-9(25)24-6-1-3-7(4-2-6)26-15(21,22)23/h1-4H,5H2,(H,24,25) |
| InChIKey | FMAGMKGTFPTHDS-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.21 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|