C13H10F3NO2S — CID 2808201
2-thiophen-2-yl-N-[4-(trifluoromethoxy)phenyl]acetamide (PubChem CID 2808201) has the molecular formula C13H10F3NO2S and a molecular weight of 301.29 g/mol. Its IUPAC name is 2-thiophen-2-yl-N-[4-(trifluoromethoxy)phenyl]acetamide.
| Compound Name | 2-thiophen-2-yl-N-[4-(trifluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 2808201 |
| Molecular Formula | C13H10F3NO2S |
| Molecular Weight | 301.29 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | 2-thiophen-2-yl-N-[4-(trifluoromethoxy)phenyl]acetamide |
| SMILES | O=C(Cc1cccs1)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C13H10F3NO2S/c14-13(15,16)19-10-5-3-9(4-6-10)17-12(18)8-11-2-1-7-20-11/h1-7H,8H2,(H,17,18) |
| InChIKey | SUDMTEWJQLJUOJ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.29 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |