C24H20N2O2S4 — CID 3108904
2-thiophen-2-yl-N-[4-[[4-[(2-thiophen-2-ylacetyl)amino]phenyl]disulfanyl]phenyl]acetamide (PubChem CID 3108904) has the molecular formula C24H20N2O2S4 and a molecular weight of 496.70 g/mol. Its IUPAC name is 2-thiophen-2-yl-N-[4-[[4-[(2-thiophen-2-ylacetyl)amino]phenyl]disulfanyl]phenyl]acetamide.
| Compound Name | 2-thiophen-2-yl-N-[4-[[4-[(2-thiophen-2-ylacetyl)amino]phenyl]disulfanyl]phenyl]acetamide |
|---|---|
| PubChem CID | 3108904 |
| Molecular Formula | C24H20N2O2S4 |
| Molecular Weight | 496.70 g/mol |
| Exact Mass | 496.04 |
| IUPAC Name | 2-thiophen-2-yl-N-[4-[[4-[(2-thiophen-2-ylacetyl)amino]phenyl]disulfanyl]phenyl]acetamide |
| SMILES | O=C(Cc1cccs1)Nc1ccc(SSc2ccc(NC(=O)Cc3cccs3)cc2)cc1 |
| InChI | InChI=1S/C24H20N2O2S4/c27-23(15-21-3-1-13-29-21)25-17-5-9-19(10-6-17)31-32-20-11-7-18(8-12-20)26-24(28)16-22-4-2-14-30-22/h1-14H,15-16H2,(H,25,27)(H,26,28) |
| InChIKey | PNQSGAYMUWWYNX-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.70 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|