C17H16N2O2S — CID 112981805
N-[4-(furan-2-ylmethylamino)phenyl]-2-thiophen-2-ylacetamide (PubChem CID 112981805) has the molecular formula C17H16N2O2S and a molecular weight of 312.39 g/mol. Its IUPAC name is N-[4-(furan-2-ylmethylamino)phenyl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[4-(furan-2-ylmethylamino)phenyl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 112981805 |
| Molecular Formula | C17H16N2O2S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | N-[4-(furan-2-ylmethylamino)phenyl]-2-thiophen-2-ylacetamide |
| SMILES | O=C(Cc1cccs1)Nc1ccc(NCc2ccco2)cc1 |
| InChI | InChI=1S/C17H16N2O2S/c20-17(11-16-4-2-10-22-16)19-14-7-5-13(6-8-14)18-12-15-3-1-9-21-15/h1-10,18H,11-12H2,(H,19,20) |
| InChIKey | OPECNZRWBVNNCG-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |