C18H16N2O2 — CID 112981782
N-[4-(furan-2-ylmethylamino)phenyl]benzamide (PubChem CID 112981782) has the molecular formula C18H16N2O2 and a molecular weight of 292.34 g/mol. Its IUPAC name is N-[4-(furan-2-ylmethylamino)phenyl]benzamide.
| Compound Name | N-[4-(furan-2-ylmethylamino)phenyl]benzamide |
|---|---|
| PubChem CID | 112981782 |
| Molecular Formula | C18H16N2O2 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | N-[4-(furan-2-ylmethylamino)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(NCc2ccco2)cc1)c1ccccc1 |
| InChI | InChI=1S/C18H16N2O2/c21-18(14-5-2-1-3-6-14)20-16-10-8-15(9-11-16)19-13-17-7-4-12-22-17/h1-12,19H,13H2,(H,20,21) |
| InChIKey | IISKAFZFFIIKGI-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |