C19H16N2O4 — CID 112981821
N-[4-(furan-2-ylmethylamino)phenyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 112981821) has the molecular formula C19H16N2O4 and a molecular weight of 336.35 g/mol. Its IUPAC name is N-[4-(furan-2-ylmethylamino)phenyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[4-(furan-2-ylmethylamino)phenyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 112981821 |
| Molecular Formula | C19H16N2O4 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | N-[4-(furan-2-ylmethylamino)phenyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(Nc1ccc(NCc2ccco2)cc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H16N2O4/c22-19(13-3-8-17-18(10-13)25-12-24-17)21-15-6-4-14(5-7-15)20-11-16-2-1-9-23-16/h1-10,20H,11-12H2,(H,21,22) |
| InChIKey | GYRSGTXVGSVMRW-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 72.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |