C14H14N2O4 — CID 108996348
2-(1,3-benzodioxol-5-ylamino)-N-(furan-2-ylmethyl)acetamide (PubChem CID 108996348) has the molecular formula C14H14N2O4 and a molecular weight of 274.28 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylamino)-N-(furan-2-ylmethyl)acetamide.
| Compound Name | 2-(1,3-benzodioxol-5-ylamino)-N-(furan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 108996348 |
| Molecular Formula | C14H14N2O4 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylamino)-N-(furan-2-ylmethyl)acetamide |
| SMILES | O=C(CNc1ccc2c(c1)OCO2)NCc1ccco1 |
| InChI | InChI=1S/C14H14N2O4/c17-14(16-7-11-2-1-5-18-11)8-15-10-3-4-12-13(6-10)20-9-19-12/h1-6,15H,7-9H2,(H,16,17) |
| InChIKey | XFDCRUKFILDRPQ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 72.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|