C13H12Cl2N2O2 — CID 31666642
2-(3,5-dichloroanilino)-N-(furan-2-ylmethyl)acetamide (PubChem CID 31666642) has the molecular formula C13H12Cl2N2O2 and a molecular weight of 299.16 g/mol. Its IUPAC name is 2-(3,5-dichloroanilino)-N-(furan-2-ylmethyl)acetamide.
| Compound Name | 2-(3,5-dichloroanilino)-N-(furan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 31666642 |
| Molecular Formula | C13H12Cl2N2O2 |
| Molecular Weight | 299.16 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | 2-(3,5-dichloroanilino)-N-(furan-2-ylmethyl)acetamide |
| SMILES | O=C(CNc1cc(Cl)cc(Cl)c1)NCc1ccco1 |
| InChI | InChI=1S/C13H12Cl2N2O2/c14-9-4-10(15)6-11(5-9)16-8-13(18)17-7-12-2-1-3-19-12/h1-6,16H,7-8H2,(H,17,18) |
| InChIKey | HWDJLEJVWDVSOS-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.16 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |