C12H12ClN3O3 — CID 18150991
4-chloro-N-[2-(furan-2-ylmethylamino)-2-oxoethyl]-1H-pyrrole-2-carboxamide (PubChem CID 18150991) has the molecular formula C12H12ClN3O3 and a molecular weight of 281.70 g/mol. Its IUPAC name is 4-chloro-N-[2-(furan-2-ylmethylamino)-2-oxoethyl]-1H-pyrrole-2-carboxamide.
| Compound Name | 4-chloro-N-[2-(furan-2-ylmethylamino)-2-oxoethyl]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 18150991 |
| Molecular Formula | C12H12ClN3O3 |
| Molecular Weight | 281.70 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | 4-chloro-N-[2-(furan-2-ylmethylamino)-2-oxoethyl]-1H-pyrrole-2-carboxamide |
| SMILES | O=C(CNC(=O)c1cc(Cl)c[nH]1)NCc1ccco1 |
| InChI | InChI=1S/C12H12ClN3O3/c13-8-4-10(14-5-8)12(18)16-7-11(17)15-6-9-2-1-3-19-9/h1-5,14H,6-7H2,(H,15,17)(H,16,18) |
| InChIKey | KLORTKWZIFNUKS-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 87.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.70 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |