C14H13Cl2N3O3 — CID 18101847
2-[(3,4-dichlorophenyl)carbamoylamino]-N-(furan-2-ylmethyl)acetamide (PubChem CID 18101847) has the molecular formula C14H13Cl2N3O3 and a molecular weight of 342.18 g/mol. Its IUPAC name is 2-[(3,4-dichlorophenyl)carbamoylamino]-N-(furan-2-ylmethyl)acetamide.
| Compound Name | 2-[(3,4-dichlorophenyl)carbamoylamino]-N-(furan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 18101847 |
| Molecular Formula | C14H13Cl2N3O3 |
| Molecular Weight | 342.18 g/mol |
| Exact Mass | 341.03 |
| IUPAC Name | 2-[(3,4-dichlorophenyl)carbamoylamino]-N-(furan-2-ylmethyl)acetamide |
| SMILES | O=C(CNC(=O)Nc1ccc(Cl)c(Cl)c1)NCc1ccco1 |
| InChI | InChI=1S/C14H13Cl2N3O3/c15-11-4-3-9(6-12(11)16)19-14(21)18-8-13(20)17-7-10-2-1-5-22-10/h1-6H,7-8H2,(H,17,20)(H2,18,19,21) |
| InChIKey | DEPPOFGMPWAJPB-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.18 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |