C15H13F4N3O3 — CID 60598074
2-[[4-fluoro-3-(trifluoromethyl)phenyl]carbamoylamino]-N-(furan-2-ylmethyl)acetamide (PubChem CID 60598074) has the molecular formula C15H13F4N3O3 and a molecular weight of 359.28 g/mol. Its IUPAC name is 2-[[4-fluoro-3-(trifluoromethyl)phenyl]carbamoylamino]-N-(furan-2-ylmethyl)acetamide.
| Compound Name | 2-[[4-fluoro-3-(trifluoromethyl)phenyl]carbamoylamino]-N-(furan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 60598074 |
| Molecular Formula | C15H13F4N3O3 |
| Molecular Weight | 359.28 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | 2-[[4-fluoro-3-(trifluoromethyl)phenyl]carbamoylamino]-N-(furan-2-ylmethyl)acetamide |
| SMILES | O=C(CNC(=O)Nc1ccc(F)c(C(F)(F)F)c1)NCc1ccco1 |
| InChI | InChI=1S/C15H13F4N3O3/c16-12-4-3-9(6-11(12)15(17,18)19)22-14(24)21-8-13(23)20-7-10-2-1-5-25-10/h1-6H,7-8H2,(H,20,23)(H2,21,22,24) |
| InChIKey | UFLPPDASHLNJMX-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.28 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |