C16H14BrFN2O3 — CID 9080417
(E)-3-(5-bromo-2-fluorophenyl)-N-[2-(furan-2-ylmethylamino)-2-oxoethyl]prop-2-enamide (PubChem CID 9080417) has the molecular formula C16H14BrFN2O3 and a molecular weight of 381.20 g/mol. Its IUPAC name is (E)-3-(5-bromo-2-fluorophenyl)-N-[2-(furan-2-ylmethylamino)-2-oxoethyl]prop-2-enamide.
| Compound Name | (E)-3-(5-bromo-2-fluorophenyl)-N-[2-(furan-2-ylmethylamino)-2-oxoethyl]prop-2-enamide |
|---|---|
| PubChem CID | 9080417 |
| Molecular Formula | C16H14BrFN2O3 |
| Molecular Weight | 381.20 g/mol |
| Exact Mass | 380.02 |
| IUPAC Name | (E)-3-(5-bromo-2-fluorophenyl)-N-[2-(furan-2-ylmethylamino)-2-oxoethyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1cc(Br)ccc1F)NCC(=O)NCc1ccco1 |
| InChI | InChI=1S/C16H14BrFN2O3/c17-12-4-5-14(18)11(8-12)3-6-15(21)20-10-16(22)19-9-13-2-1-7-23-13/h1-8H,9-10H2,(H,19,22)(H,20,21)/b6-3+ |
| InChIKey | KQUPMSPLQXDZGC-ZZXKWVIFSA-N |
| XLogP | 2.63 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.20 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|