C12H13BrFNO2 — CID 30281164
(E)-3-(5-bromo-2-fluorophenyl)-N-(2-methoxyethyl)prop-2-enamide (PubChem CID 30281164) has the molecular formula C12H13BrFNO2 and a molecular weight of 302.14 g/mol. Its IUPAC name is (E)-3-(5-bromo-2-fluorophenyl)-N-(2-methoxyethyl)prop-2-enamide.
| Compound Name | (E)-3-(5-bromo-2-fluorophenyl)-N-(2-methoxyethyl)prop-2-enamide |
|---|---|
| PubChem CID | 30281164 |
| Molecular Formula | C12H13BrFNO2 |
| Molecular Weight | 302.14 g/mol |
| Exact Mass | 301.01 |
| IUPAC Name | (E)-3-(5-bromo-2-fluorophenyl)-N-(2-methoxyethyl)prop-2-enamide |
| SMILES | COCCNC(=O)/C=C/c1cc(Br)ccc1F |
| InChI | InChI=1S/C12H13BrFNO2/c1-17-7-6-15-12(16)5-2-9-8-10(13)3-4-11(9)14/h2-5,8H,6-7H2,1H3,(H,15,16)/b5-2+ |
| InChIKey | SAKYNVFTKAMOCN-GORDUTHDSA-N |
| XLogP | 2.36 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.14 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|