C13H13BrFNO3 — CID 43092009
4-[[(E)-3-(5-bromo-2-fluorophenyl)prop-2-enoyl]amino]butanoic acid (PubChem CID 43092009) has the molecular formula C13H13BrFNO3 and a molecular weight of 330.15 g/mol. Its IUPAC name is 4-[[(E)-3-(5-bromo-2-fluorophenyl)prop-2-enoyl]amino]butanoic acid.
| Compound Name | 4-[[(E)-3-(5-bromo-2-fluorophenyl)prop-2-enoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 43092009 |
| Molecular Formula | C13H13BrFNO3 |
| Molecular Weight | 330.15 g/mol |
| Exact Mass | 329.01 |
| IUPAC Name | 4-[[(E)-3-(5-bromo-2-fluorophenyl)prop-2-enoyl]amino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)/C=C/c1cc(Br)ccc1F |
| InChI | InChI=1S/C13H13BrFNO3/c14-10-4-5-11(15)9(8-10)3-6-12(17)16-7-1-2-13(18)19/h3-6,8H,1-2,7H2,(H,16,17)(H,18,19)/b6-3+ |
| InChIKey | NLKLCAPZUWRDIX-ZZXKWVIFSA-N |
| XLogP | 2.58 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.15 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|