C17H15BrFNO2 — CID 7959627
(E)-3-(5-bromo-2-fluorophenyl)-N-[(4-methoxyphenyl)methyl]prop-2-enamide (PubChem CID 7959627) has the molecular formula C17H15BrFNO2 and a molecular weight of 364.21 g/mol. Its IUPAC name is (E)-3-(5-bromo-2-fluorophenyl)-N-[(4-methoxyphenyl)methyl]prop-2-enamide.
| Compound Name | (E)-3-(5-bromo-2-fluorophenyl)-N-[(4-methoxyphenyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 7959627 |
| Molecular Formula | C17H15BrFNO2 |
| Molecular Weight | 364.21 g/mol |
| Exact Mass | 363.03 |
| IUPAC Name | (E)-3-(5-bromo-2-fluorophenyl)-N-[(4-methoxyphenyl)methyl]prop-2-enamide |
| SMILES | COc1ccc(CNC(=O)/C=C/c2cc(Br)ccc2F)cc1 |
| InChI | InChI=1S/C17H15BrFNO2/c1-22-15-6-2-12(3-7-15)11-20-17(21)9-4-13-10-14(18)5-8-16(13)19/h2-10H,11H2,1H3,(H,20,21)/b9-4+ |
| InChIKey | CRWGMCUEXAVGED-RUDMXATFSA-N |
| XLogP | 3.93 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.21 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|