C17H15BrFN3OS — CID 7977670
1-benzyl-3-[[(E)-3-(5-bromo-2-fluorophenyl)prop-2-enoyl]amino]thiourea (PubChem CID 7977670) has the molecular formula C17H15BrFN3OS and a molecular weight of 408.30 g/mol. Its IUPAC name is 1-benzyl-3-[[(E)-3-(5-bromo-2-fluorophenyl)prop-2-enoyl]amino]thiourea.
| Compound Name | 1-benzyl-3-[[(E)-3-(5-bromo-2-fluorophenyl)prop-2-enoyl]amino]thiourea |
|---|---|
| PubChem CID | 7977670 |
| Molecular Formula | C17H15BrFN3OS |
| Molecular Weight | 408.30 g/mol |
| Exact Mass | 407.01 |
| IUPAC Name | 1-benzyl-3-[[(E)-3-(5-bromo-2-fluorophenyl)prop-2-enoyl]amino]thiourea |
| SMILES | O=C(/C=C/c1cc(Br)ccc1F)NNC(=S)NCc1ccccc1 |
| InChI | InChI=1S/C17H15BrFN3OS/c18-14-7-8-15(19)13(10-14)6-9-16(23)21-22-17(24)20-11-12-4-2-1-3-5-12/h1-10H,11H2,(H,21,23)(H2,20,22,24)/b9-6+ |
| InChIKey | GKLSVEFDYBIEJS-RMKNXTFCSA-N |
| XLogP | 3.30 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.30 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|