C15H14FN3OS2 — CID 8942724
1-[(4-fluorophenyl)methyl]-3-[[(E)-3-thiophen-2-ylprop-2-enoyl]amino]thiourea (PubChem CID 8942724) has the molecular formula C15H14FN3OS2 and a molecular weight of 335.43 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-3-[[(E)-3-thiophen-2-ylprop-2-enoyl]amino]thiourea.
| Compound Name | 1-[(4-fluorophenyl)methyl]-3-[[(E)-3-thiophen-2-ylprop-2-enoyl]amino]thiourea |
|---|---|
| PubChem CID | 8942724 |
| Molecular Formula | C15H14FN3OS2 |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-3-[[(E)-3-thiophen-2-ylprop-2-enoyl]amino]thiourea |
| SMILES | O=C(/C=C/c1cccs1)NNC(=S)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C15H14FN3OS2/c16-12-5-3-11(4-6-12)10-17-15(21)19-18-14(20)8-7-13-2-1-9-22-13/h1-9H,10H2,(H,18,20)(H2,17,19,21)/b8-7+ |
| InChIKey | KSMYUBGENKTXCX-BQYQJAHWSA-N |
| XLogP | 2.60 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|