C16H15FN2O3S — CID 9367846
(2R)-2-(4-fluorophenoxy)-N'-[(E)-3-thiophen-2-ylprop-2-enoyl]propanehydrazide (PubChem CID 9367846) has the molecular formula C16H15FN2O3S and a molecular weight of 334.37 g/mol. Its IUPAC name is (2R)-2-(4-fluorophenoxy)-N'-[(E)-3-thiophen-2-ylprop-2-enoyl]propanehydrazide.
| Compound Name | (2R)-2-(4-fluorophenoxy)-N'-[(E)-3-thiophen-2-ylprop-2-enoyl]propanehydrazide |
|---|---|
| PubChem CID | 9367846 |
| Molecular Formula | C16H15FN2O3S |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | (2R)-2-(4-fluorophenoxy)-N'-[(E)-3-thiophen-2-ylprop-2-enoyl]propanehydrazide |
| SMILES | C[C@@H](Oc1ccc(F)cc1)C(=O)NNC(=O)/C=C/c1cccs1 |
| InChI | InChI=1S/C16H15FN2O3S/c1-11(22-13-6-4-12(17)5-7-13)16(21)19-18-15(20)9-8-14-3-2-10-23-14/h2-11H,1H3,(H,18,20)(H,19,21)/b9-8+/t11-/m1/s1 |
| InChIKey | FBBYCQKGWXWIAJ-ANYFNZRUSA-N |
| XLogP | 2.52 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|