C22H21FN2O4 — CID 9091795
(2S)-N'-[(E)-3-(2-ethyl-1-benzofuran-3-yl)prop-2-enoyl]-2-(4-fluorophenoxy)propanehydrazide (PubChem CID 9091795) has the molecular formula C22H21FN2O4 and a molecular weight of 396.42 g/mol. Its IUPAC name is (2S)-N'-[(E)-3-(2-ethyl-1-benzofuran-3-yl)prop-2-enoyl]-2-(4-fluorophenoxy)propanehydrazide.
| Compound Name | (2S)-N'-[(E)-3-(2-ethyl-1-benzofuran-3-yl)prop-2-enoyl]-2-(4-fluorophenoxy)propanehydrazide |
|---|---|
| PubChem CID | 9091795 |
| Molecular Formula | C22H21FN2O4 |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | (2S)-N'-[(E)-3-(2-ethyl-1-benzofuran-3-yl)prop-2-enoyl]-2-(4-fluorophenoxy)propanehydrazide |
| SMILES | CCc1oc2ccccc2c1/C=C/C(=O)NNC(=O)[C@H](C)Oc1ccc(F)cc1 |
| InChI | InChI=1S/C22H21FN2O4/c1-3-19-18(17-6-4-5-7-20(17)29-19)12-13-21(26)24-25-22(27)14(2)28-16-10-8-15(23)9-11-16/h4-14H,3H2,1-2H3,(H,24,26)(H,25,27)/b13-12+/t14-/m0/s1 |
| InChIKey | ISUPQTXMEIJGKQ-FNDVETGQSA-N |
| XLogP | 3.76 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|