C20H21FN2O5 — CID 9368256
(2R)-N'-[(E)-3-(2,3-dimethoxyphenyl)prop-2-enoyl]-2-(4-fluorophenoxy)propanehydrazide (PubChem CID 9368256) has the molecular formula C20H21FN2O5 and a molecular weight of 388.40 g/mol. Its IUPAC name is (2R)-N'-[(E)-3-(2,3-dimethoxyphenyl)prop-2-enoyl]-2-(4-fluorophenoxy)propanehydrazide.
| Compound Name | (2R)-N'-[(E)-3-(2,3-dimethoxyphenyl)prop-2-enoyl]-2-(4-fluorophenoxy)propanehydrazide |
|---|---|
| PubChem CID | 9368256 |
| Molecular Formula | C20H21FN2O5 |
| Molecular Weight | 388.40 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | (2R)-N'-[(E)-3-(2,3-dimethoxyphenyl)prop-2-enoyl]-2-(4-fluorophenoxy)propanehydrazide |
| SMILES | COc1cccc(/C=C/C(=O)NNC(=O)[C@@H](C)Oc2ccc(F)cc2)c1OC |
| InChI | InChI=1S/C20H21FN2O5/c1-13(28-16-10-8-15(21)9-11-16)20(25)23-22-18(24)12-7-14-5-4-6-17(26-2)19(14)27-3/h4-13H,1-3H3,(H,22,24)(H,23,25)/b12-7+/t13-/m1/s1 |
| InChIKey | HMOBLEQZKLCCHY-BWODNOAJSA-N |
| XLogP | 2.47 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.40 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|