C18H18N2O4 — CID 4789480
N'-[3-(2,3-dimethoxyphenyl)prop-2-enoyl]benzohydrazide (PubChem CID 4789480) has the molecular formula C18H18N2O4 and a molecular weight of 326.35 g/mol. Its IUPAC name is N'-[3-(2,3-dimethoxyphenyl)prop-2-enoyl]benzohydrazide.
| Compound Name | N'-[3-(2,3-dimethoxyphenyl)prop-2-enoyl]benzohydrazide |
|---|---|
| PubChem CID | 4789480 |
| Molecular Formula | C18H18N2O4 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | N'-[3-(2,3-dimethoxyphenyl)prop-2-enoyl]benzohydrazide |
| SMILES | COc1cccc(C=CC(=O)NNC(=O)c2ccccc2)c1OC |
| InChI | InChI=1S/C18H18N2O4/c1-23-15-10-6-9-13(17(15)24-2)11-12-16(21)19-20-18(22)14-7-4-3-5-8-14/h3-12H,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | ZHIHXHAFDZVJMZ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|