C13H18N2O3 — CID 9163798
(E)-3-(2,3-dimethoxyphenyl)-N',N'-dimethylprop-2-enehydrazide (PubChem CID 9163798) has the molecular formula C13H18N2O3 and a molecular weight of 250.30 g/mol. Its IUPAC name is (E)-3-(2,3-dimethoxyphenyl)-N',N'-dimethylprop-2-enehydrazide.
| Compound Name | (E)-3-(2,3-dimethoxyphenyl)-N',N'-dimethylprop-2-enehydrazide |
|---|---|
| PubChem CID | 9163798 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | (E)-3-(2,3-dimethoxyphenyl)-N',N'-dimethylprop-2-enehydrazide |
| SMILES | COc1cccc(/C=C/C(=O)NN(C)C)c1OC |
| InChI | InChI=1S/C13H18N2O3/c1-15(2)14-12(16)9-8-10-6-5-7-11(17-3)13(10)18-4/h5-9H,1-4H3,(H,14,16)/b9-8+ |
| InChIKey | RCGZOKAVMSSYCP-CMDGGOBGSA-N |
| XLogP | 1.31 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|