C16H24N3O3+ — CID 9204831
(E)-3-(2,3-dimethoxyphenyl)-N-(4-methylpiperazin-4-ium-1-yl)prop-2-enamide (PubChem CID 9204831) has the molecular formula C16H24N3O3+ and a molecular weight of 306.39 g/mol. Its IUPAC name is (E)-3-(2,3-dimethoxyphenyl)-N-(4-methylpiperazin-4-ium-1-yl)prop-2-enamide.
| Compound Name | (E)-3-(2,3-dimethoxyphenyl)-N-(4-methylpiperazin-4-ium-1-yl)prop-2-enamide |
|---|---|
| PubChem CID | 9204831 |
| Molecular Formula | C16H24N3O3+ |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | (E)-3-(2,3-dimethoxyphenyl)-N-(4-methylpiperazin-4-ium-1-yl)prop-2-enamide |
| SMILES | COc1cccc(/C=C/C(=O)NN2CC[NH+](C)CC2)c1OC |
| InChI | InChI=1S/C16H23N3O3/c1-18-9-11-19(12-10-18)17-15(20)8-7-13-5-4-6-14(21-2)16(13)22-3/h4-8H,9-12H2,1-3H3,(H,17,20)/p+1/b8-7+ |
| InChIKey | HWGDDJVFSVIWLE-BQYQJAHWSA-O |
| XLogP | -0.42 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|