C18H19N3O4 — CID 46518654
(E)-N-[4-(carbamoylamino)phenyl]-3-(2,3-dimethoxyphenyl)prop-2-enamide (PubChem CID 46518654) has the molecular formula C18H19N3O4 and a molecular weight of 341.37 g/mol. Its IUPAC name is (E)-N-[4-(carbamoylamino)phenyl]-3-(2,3-dimethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[4-(carbamoylamino)phenyl]-3-(2,3-dimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 46518654 |
| Molecular Formula | C18H19N3O4 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | (E)-N-[4-(carbamoylamino)phenyl]-3-(2,3-dimethoxyphenyl)prop-2-enamide |
| SMILES | COc1cccc(/C=C/C(=O)Nc2ccc(NC(N)=O)cc2)c1OC |
| InChI | InChI=1S/C18H19N3O4/c1-24-15-5-3-4-12(17(15)25-2)6-11-16(22)20-13-7-9-14(10-8-13)21-18(19)23/h3-11H,1-2H3,(H,20,22)(H3,19,21,23)/b11-6+ |
| InChIKey | CRQCAKYCDXTACK-IZZDOVSWSA-N |
| XLogP | 2.85 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|