C18H20N2O5S — CID 9140940
(E)-3-(2,3-dimethoxyphenyl)-N-(4-methyl-3-sulfamoylphenyl)prop-2-enamide (PubChem CID 9140940) has the molecular formula C18H20N2O5S and a molecular weight of 376.43 g/mol. Its IUPAC name is (E)-3-(2,3-dimethoxyphenyl)-N-(4-methyl-3-sulfamoylphenyl)prop-2-enamide.
| Compound Name | (E)-3-(2,3-dimethoxyphenyl)-N-(4-methyl-3-sulfamoylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 9140940 |
| Molecular Formula | C18H20N2O5S |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | (E)-3-(2,3-dimethoxyphenyl)-N-(4-methyl-3-sulfamoylphenyl)prop-2-enamide |
| SMILES | COc1cccc(/C=C/C(=O)Nc2ccc(C)c(S(N)(=O)=O)c2)c1OC |
| InChI | InChI=1S/C18H20N2O5S/c1-12-7-9-14(11-16(12)26(19,22)23)20-17(21)10-8-13-5-4-6-15(24-2)18(13)25-3/h4-11H,1-3H3,(H,20,21)(H2,19,22,23)/b10-8+ |
| InChIKey | NKXUCFZTLOUWRS-CSKARUKUSA-N |
| XLogP | 2.31 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|