C19H17N3O3S — CID 55510584
(E)-N-(4-methyl-3-sulfamoylphenyl)-3-quinolin-8-ylprop-2-enamide (PubChem CID 55510584) has the molecular formula C19H17N3O3S and a molecular weight of 367.43 g/mol. Its IUPAC name is (E)-N-(4-methyl-3-sulfamoylphenyl)-3-quinolin-8-ylprop-2-enamide.
| Compound Name | (E)-N-(4-methyl-3-sulfamoylphenyl)-3-quinolin-8-ylprop-2-enamide |
|---|---|
| PubChem CID | 55510584 |
| Molecular Formula | C19H17N3O3S |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | (E)-N-(4-methyl-3-sulfamoylphenyl)-3-quinolin-8-ylprop-2-enamide |
| SMILES | Cc1ccc(NC(=O)/C=C/c2cccc3cccnc23)cc1S(N)(=O)=O |
| InChI | InChI=1S/C19H17N3O3S/c1-13-7-9-16(12-17(13)26(20,24)25)22-18(23)10-8-15-5-2-4-14-6-3-11-21-19(14)15/h2-12H,1H3,(H,22,23)(H2,20,24,25)/b10-8+ |
| InChIKey | BTGZVEFMDZNQLP-CSKARUKUSA-N |
| XLogP | 2.84 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|