C14H18ClFN3O+ — CID 7028624
(E)-3-(2-chloro-6-fluorophenyl)-N-(4-methylpiperazin-4-ium-1-yl)prop-2-enamide (PubChem CID 7028624) has the molecular formula C14H18ClFN3O+ and a molecular weight of 298.77 g/mol. Its IUPAC name is (E)-3-(2-chloro-6-fluorophenyl)-N-(4-methylpiperazin-4-ium-1-yl)prop-2-enamide.
| Compound Name | (E)-3-(2-chloro-6-fluorophenyl)-N-(4-methylpiperazin-4-ium-1-yl)prop-2-enamide |
|---|---|
| PubChem CID | 7028624 |
| Molecular Formula | C14H18ClFN3O+ |
| Molecular Weight | 298.77 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | (E)-3-(2-chloro-6-fluorophenyl)-N-(4-methylpiperazin-4-ium-1-yl)prop-2-enamide |
| SMILES | C[NH+]1CCN(NC(=O)/C=C/c2c(F)cccc2Cl)CC1 |
| InChI | InChI=1S/C14H17ClFN3O/c1-18-7-9-19(10-8-18)17-14(20)6-5-11-12(15)3-2-4-13(11)16/h2-6H,7-10H2,1H3,(H,17,20)/p+1/b6-5+ |
| InChIKey | VRNQGDGGTMDZKI-AATRIKPKSA-O |
| XLogP | 0.35 |
| TPSA | 36.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.77 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|