C14H15ClFNO3 — CID 43354105
2-[[(E)-3-(2-chloro-6-fluorophenyl)prop-2-enoyl]amino]-3-methylbutanoic acid (PubChem CID 43354105) has the molecular formula C14H15ClFNO3 and a molecular weight of 299.73 g/mol. Its IUPAC name is 2-[[(E)-3-(2-chloro-6-fluorophenyl)prop-2-enoyl]amino]-3-methylbutanoic acid.
| Compound Name | 2-[[(E)-3-(2-chloro-6-fluorophenyl)prop-2-enoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 43354105 |
| Molecular Formula | C14H15ClFNO3 |
| Molecular Weight | 299.73 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | 2-[[(E)-3-(2-chloro-6-fluorophenyl)prop-2-enoyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)C(NC(=O)/C=C/c1c(F)cccc1Cl)C(=O)O |
| InChI | InChI=1S/C14H15ClFNO3/c1-8(2)13(14(19)20)17-12(18)7-6-9-10(15)4-3-5-11(9)16/h3-8,13H,1-2H3,(H,17,18)(H,19,20)/b7-6+ |
| InChIKey | ZUGRLLZIVLDXKH-VOTSOKGWSA-N |
| XLogP | 2.72 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.73 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|