C12H11ClFNO — CID 3685780
3-(2-chloro-6-fluorophenyl)-N-cyclopropylprop-2-enamide (PubChem CID 3685780) has the molecular formula C12H11ClFNO and a molecular weight of 239.68 g/mol. Its IUPAC name is 3-(2-chloro-6-fluorophenyl)-N-cyclopropylprop-2-enamide.
| Compound Name | 3-(2-chloro-6-fluorophenyl)-N-cyclopropylprop-2-enamide |
|---|---|
| PubChem CID | 3685780 |
| Molecular Formula | C12H11ClFNO |
| Molecular Weight | 239.68 g/mol |
| Exact Mass | 239.05 |
| IUPAC Name | 3-(2-chloro-6-fluorophenyl)-N-cyclopropylprop-2-enamide |
| SMILES | O=C(C=Cc1c(F)cccc1Cl)NC1CC1 |
| InChI | InChI=1S/C12H11ClFNO/c13-10-2-1-3-11(14)9(10)6-7-12(16)15-8-4-5-8/h1-3,6-8H,4-5H2,(H,15,16) |
| InChIKey | YMWVXQJCBXVRRT-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.68 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|