C24H24Cl2N2O2 — CID 6265521
(E)-3-(2-chlorophenyl)-N-[4-[[(E)-3-(2-chlorophenyl)prop-2-enoyl]amino]cyclohexyl]prop-2-enamide (PubChem CID 6265521) has the molecular formula C24H24Cl2N2O2 and a molecular weight of 443.37 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-N-[4-[[(E)-3-(2-chlorophenyl)prop-2-enoyl]amino]cyclohexyl]prop-2-enamide.
| Compound Name | (E)-3-(2-chlorophenyl)-N-[4-[[(E)-3-(2-chlorophenyl)prop-2-enoyl]amino]cyclohexyl]prop-2-enamide |
|---|---|
| PubChem CID | 6265521 |
| Molecular Formula | C24H24Cl2N2O2 |
| Molecular Weight | 443.37 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-N-[4-[[(E)-3-(2-chlorophenyl)prop-2-enoyl]amino]cyclohexyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1Cl)NC1CCC(NC(=O)/C=C/c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C24H24Cl2N2O2/c25-21-7-3-1-5-17(21)9-15-23(29)27-19-11-13-20(14-12-19)28-24(30)16-10-18-6-2-4-8-22(18)26/h1-10,15-16,19-20H,11-14H2,(H,27,29)(H,28,30)/b15-9+,16-10+ |
| InChIKey | SGJGKEKIKCERJD-KAVGSWPWSA-N |
| XLogP | 5.26 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.37 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|