C17H22ClNO — CID 966037
3-(2-chlorophenyl)-N-cyclooctylprop-2-enamide (PubChem CID 966037) has the molecular formula C17H22ClNO and a molecular weight of 291.82 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-N-cyclooctylprop-2-enamide.
| Compound Name | 3-(2-chlorophenyl)-N-cyclooctylprop-2-enamide |
|---|---|
| PubChem CID | 966037 |
| Molecular Formula | C17H22ClNO |
| Molecular Weight | 291.82 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 3-(2-chlorophenyl)-N-cyclooctylprop-2-enamide |
| SMILES | O=C(C=Cc1ccccc1Cl)NC1CCCCCCC1 |
| InChI | InChI=1S/C17H22ClNO/c18-16-11-7-6-8-14(16)12-13-17(20)19-15-9-4-2-1-3-5-10-15/h6-8,11-13,15H,1-5,9-10H2,(H,19,20) |
| InChIKey | OWYHIEMDJNBUFE-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.82 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|