C16H21NO2 — CID 97305713
(Z)-N-cyclopentyl-3-(2-ethoxyphenyl)prop-2-enamide (PubChem CID 97305713) has the molecular formula C16H21NO2 and a molecular weight of 259.35 g/mol. Its IUPAC name is (Z)-N-cyclopentyl-3-(2-ethoxyphenyl)prop-2-enamide.
| Compound Name | (Z)-N-cyclopentyl-3-(2-ethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 97305713 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | (Z)-N-cyclopentyl-3-(2-ethoxyphenyl)prop-2-enamide |
| SMILES | CCOc1ccccc1/C=C\C(=O)NC1CCCC1 |
| InChI | InChI=1S/C16H21NO2/c1-2-19-15-10-6-3-7-13(15)11-12-16(18)17-14-8-4-5-9-14/h3,6-7,10-12,14H,2,4-5,8-9H2,1H3,(H,17,18)/b12-11- |
| InChIKey | ISWTZQAGQGLJDO-QXMHVHEDSA-N |
| XLogP | 3.16 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|