C21H28N2O5 — CID 55322137
[1-(cyclohexylcarbamoylamino)-1-oxopropan-2-yl] (E)-3-(2-ethoxyphenyl)prop-2-enoate (PubChem CID 55322137) has the molecular formula C21H28N2O5 and a molecular weight of 388.46 g/mol. Its IUPAC name is [1-(cyclohexylcarbamoylamino)-1-oxopropan-2-yl] (E)-3-(2-ethoxyphenyl)prop-2-enoate.
| Compound Name | [1-(cyclohexylcarbamoylamino)-1-oxopropan-2-yl] (E)-3-(2-ethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 55322137 |
| Molecular Formula | C21H28N2O5 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | [1-(cyclohexylcarbamoylamino)-1-oxopropan-2-yl] (E)-3-(2-ethoxyphenyl)prop-2-enoate |
| SMILES | CCOc1ccccc1/C=C/C(=O)OC(C)C(=O)NC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C21H28N2O5/c1-3-27-18-12-8-7-9-16(18)13-14-19(24)28-15(2)20(25)23-21(26)22-17-10-5-4-6-11-17/h7-9,12-15,17H,3-6,10-11H2,1-2H3,(H2,22,23,25,26)/b14-13+ |
| InChIKey | XWXWUAPLTVOSIC-BUHFOSPRSA-N |
| XLogP | 3.19 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|