C16H21NO3 — CID 83203007
(E)-N-cyclopentyloxy-3-(2-ethoxyphenyl)prop-2-enamide (PubChem CID 83203007) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is (E)-N-cyclopentyloxy-3-(2-ethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-cyclopentyloxy-3-(2-ethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 83203007 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | (E)-N-cyclopentyloxy-3-(2-ethoxyphenyl)prop-2-enamide |
| SMILES | CCOc1ccccc1/C=C/C(=O)NOC1CCCC1 |
| InChI | InChI=1S/C16H21NO3/c1-2-19-15-10-6-3-7-13(15)11-12-16(18)17-20-14-8-4-5-9-14/h3,6-7,10-12,14H,2,4-5,8-9H2,1H3,(H,17,18)/b12-11+ |
| InChIKey | MOQIGZIWHREHCB-VAWYXSNFSA-N |
| XLogP | 3.09 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|