C14H16BrNO2 — CID 83202500
(E)-3-(2-bromophenyl)-N-cyclopentyloxyprop-2-enamide (PubChem CID 83202500) has the molecular formula C14H16BrNO2 and a molecular weight of 310.19 g/mol. Its IUPAC name is (E)-3-(2-bromophenyl)-N-cyclopentyloxyprop-2-enamide.
| Compound Name | (E)-3-(2-bromophenyl)-N-cyclopentyloxyprop-2-enamide |
|---|---|
| PubChem CID | 83202500 |
| Molecular Formula | C14H16BrNO2 |
| Molecular Weight | 310.19 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | (E)-3-(2-bromophenyl)-N-cyclopentyloxyprop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1Br)NOC1CCCC1 |
| InChI | InChI=1S/C14H16BrNO2/c15-13-8-4-1-5-11(13)9-10-14(17)16-18-12-6-2-3-7-12/h1,4-5,8-10,12H,2-3,6-7H2,(H,16,17)/b10-9+ |
| InChIKey | SWHRPCKIEDQJTP-MDZDMXLPSA-N |
| XLogP | 3.45 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.19 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|