C14H15Cl2NO2 — CID 83235404
(E)-N-cyclopentyloxy-3-(2,5-dichlorophenyl)prop-2-enamide (PubChem CID 83235404) has the molecular formula C14H15Cl2NO2 and a molecular weight of 300.19 g/mol. Its IUPAC name is (E)-N-cyclopentyloxy-3-(2,5-dichlorophenyl)prop-2-enamide.
| Compound Name | (E)-N-cyclopentyloxy-3-(2,5-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 83235404 |
| Molecular Formula | C14H15Cl2NO2 |
| Molecular Weight | 300.19 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | (E)-N-cyclopentyloxy-3-(2,5-dichlorophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1cc(Cl)ccc1Cl)NOC1CCCC1 |
| InChI | InChI=1S/C14H15Cl2NO2/c15-11-6-7-13(16)10(9-11)5-8-14(18)17-19-12-3-1-2-4-12/h5-9,12H,1-4H2,(H,17,18)/b8-5+ |
| InChIKey | XBSQJVVVNXXGPE-VMPITWQZSA-N |
| XLogP | 4.00 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.19 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|