C13H15Cl2NO4 — CID 107845891
(E)-3-(2,5-dichlorophenyl)-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]prop-2-enamide (PubChem CID 107845891) has the molecular formula C13H15Cl2NO4 and a molecular weight of 320.17 g/mol. Its IUPAC name is (E)-3-(2,5-dichlorophenyl)-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]prop-2-enamide.
| Compound Name | (E)-3-(2,5-dichlorophenyl)-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 107845891 |
| Molecular Formula | C13H15Cl2NO4 |
| Molecular Weight | 320.17 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | (E)-3-(2,5-dichlorophenyl)-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]prop-2-enamide |
| SMILES | O=C(/C=C/c1cc(Cl)ccc1Cl)NC(CO)(CO)CO |
| InChI | InChI=1S/C13H15Cl2NO4/c14-10-2-3-11(15)9(5-10)1-4-12(20)16-13(6-17,7-18)8-19/h1-5,17-19H,6-8H2,(H,16,20)/b4-1+ |
| InChIKey | GTUIXMVQVRHHKX-DAFODLJHSA-N |
| XLogP | 0.84 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.17 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|